C16H21FN4 — CID 117210305
1-[5-[(3-fluorophenyl)methyl]-1-methylpyrazol-4-yl]piperidin-4-amine (PubChem CID 117210305) has the molecular formula C16H21FN4 and a molecular weight of 288.37 g/mol. Its IUPAC name is 1-[5-[(3-fluorophenyl)methyl]-1-methylpyrazol-4-yl]piperidin-4-amine.
| Compound Name | 1-[5-[(3-fluorophenyl)methyl]-1-methylpyrazol-4-yl]piperidin-4-amine |
|---|---|
| PubChem CID | 117210305 |
| Molecular Formula | C16H21FN4 |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | 1-[5-[(3-fluorophenyl)methyl]-1-methylpyrazol-4-yl]piperidin-4-amine |
| SMILES | Cn1ncc(N2CCC(N)CC2)c1Cc1cccc(F)c1 |
| InChI | InChI=1S/C16H21FN4/c1-20-15(10-12-3-2-4-13(17)9-12)16(11-19-20)21-7-5-14(18)6-8-21/h2-4,9,11,14H,5-8,10,18H2,1H3 |
| InChIKey | HQXJRUDTJCZZGB-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 47.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |