C18H26N4 — CID 117210699
1-[1-(3-methylphenyl)-5-propan-2-ylpyrazol-4-yl]piperidin-4-amine (PubChem CID 117210699) has the molecular formula C18H26N4 and a molecular weight of 298.43 g/mol. Its IUPAC name is 1-[1-(3-methylphenyl)-5-propan-2-ylpyrazol-4-yl]piperidin-4-amine.
| Compound Name | 1-[1-(3-methylphenyl)-5-propan-2-ylpyrazol-4-yl]piperidin-4-amine |
|---|---|
| PubChem CID | 117210699 |
| Molecular Formula | C18H26N4 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.22 |
| IUPAC Name | 1-[1-(3-methylphenyl)-5-propan-2-ylpyrazol-4-yl]piperidin-4-amine |
| SMILES | Cc1cccc(-n2ncc(N3CCC(N)CC3)c2C(C)C)c1 |
| InChI | InChI=1S/C18H26N4/c1-13(2)18-17(21-9-7-15(19)8-10-21)12-20-22(18)16-6-4-5-14(3)11-16/h4-6,11-13,15H,7-10,19H2,1-3H3 |
| InChIKey | UFPBMQGPSIAIPI-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 47.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |