C14H17ClN4 — CID 117211122
N'-[4-(3-chlorophenyl)-2-methylpyrimidin-5-yl]propane-1,3-diamine (PubChem CID 117211122) has the molecular formula C14H17ClN4 and a molecular weight of 276.77 g/mol. Its IUPAC name is N'-[4-(3-chlorophenyl)-2-methylpyrimidin-5-yl]propane-1,3-diamine.
| Compound Name | N'-[4-(3-chlorophenyl)-2-methylpyrimidin-5-yl]propane-1,3-diamine |
|---|---|
| PubChem CID | 117211122 |
| Molecular Formula | C14H17ClN4 |
| Molecular Weight | 276.77 g/mol |
| Exact Mass | 276.11 |
| IUPAC Name | N'-[4-(3-chlorophenyl)-2-methylpyrimidin-5-yl]propane-1,3-diamine |
| SMILES | Cc1ncc(NCCCN)c(-c2cccc(Cl)c2)n1 |
| InChI | InChI=1S/C14H17ClN4/c1-10-18-9-13(17-7-3-6-16)14(19-10)11-4-2-5-12(15)8-11/h2,4-5,8-9,17H,3,6-7,16H2,1H3 |
| InChIKey | HTPHQBLSVHHQOU-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.77 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|