About N'-[4-(2-chlorophenyl)-2-cyclobutylpyrimidin-5-yl]ethane-1,2-diamine
N'-[4-(2-chlorophenyl)-2-cyclobutylpyrimidin-5-yl]ethane-1,2-diamine (PubChem CID 117211824) has the molecular formula C16H19ClN4
and a molecular weight of 302.81 g/mol. Its IUPAC name is N'-[4-(2-chlorophenyl)-2-cyclobutylpyrimidin-5-yl]ethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-[4-(2-chlorophenyl)-2-cyclobutylpyrimidin-5-yl]ethane-1,2-diamine |
| PubChem CID | 117211824 |
| Molecular Formula | C16H19ClN4 |
| Molecular Weight | 302.81 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | N'-[4-(2-chlorophenyl)-2-cyclobutylpyrimidin-5-yl]ethane-1,2-diamine |
| SMILES | NCCNc1cnc(C2CCC2)nc1-c1ccccc1Cl |
| InChI | InChI=1S/C16H19ClN4/c17-13-7-2-1-6-12(13)15-14(19-9-8-18)10-20-16(21-15)11-4-3-5-11/h1-2,6-7,10-11,19H,3-5,8-9,18H2 |
| InChIKey | NBWLPZQOHSGFTE-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.81 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N'-[4-(2-chlorophenyl)-2-cyclobutylpyrimidin-5-yl]ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[4-(2-chlorophenyl)-2-cyclobutylpyrimidin-5-yl]ethane-1,2-diamine?
The IUPAC name of N'-[4-(2-chlorophenyl)-2-cyclobutylpyrimidin-5-yl]ethane-1,2-diamine (CID 117211824) is N'-[4-(2-chlorophenyl)-2-cyclobutylpyrimidin-5-yl]ethane-1,2-diamine.
What is the SMILES notation for N'-[4-(2-chlorophenyl)-2-cyclobutylpyrimidin-5-yl]ethane-1,2-diamine?
The canonical SMILES for N'-[4-(2-chlorophenyl)-2-cyclobutylpyrimidin-5-yl]ethane-1,2-diamine is NCCNc1cnc(C2CCC2)nc1-c1ccccc1Cl.
What is the InChIKey of N'-[4-(2-chlorophenyl)-2-cyclobutylpyrimidin-5-yl]ethane-1,2-diamine?
The InChIKey is NBWLPZQOHSGFTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19ClN4/c17-13-7-2-1-6-12(13)15-14(19-9-8-18)10-20-16(21-15)11-4-3-5-11/h1-2,6-7,10-11,19H,3-5,8-9,18H2.
What are the key properties of N'-[4-(2-chlorophenyl)-2-cyclobutylpyrimidin-5-yl]ethane-1,2-diamine?
N'-[4-(2-chlorophenyl)-2-cyclobutylpyrimidin-5-yl]ethane-1,2-diamine has a molecular weight of 302.81 g/mol, XLogP of 3.44, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[4-(2-chlorophenyl)-2-cyclobutylpyrimidin-5-yl]ethane-1,2-diamine is sourced from PubChem (CID 117211824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).