About 4-amino-N,N-dimethylpyrimidine-2-carboxamide
4-amino-N,N-dimethylpyrimidine-2-carboxamide (PubChem CID 117212988) has the molecular formula C7H10N4O
and a molecular weight of 166.18 g/mol. Its IUPAC name is 4-amino-N,N-dimethylpyrimidine-2-carboxamide.
Molecular Properties
| Compound Name | 4-amino-N,N-dimethylpyrimidine-2-carboxamide |
| PubChem CID | 117212988 |
| Molecular Formula | C7H10N4O |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.09 |
| IUPAC Name | 4-amino-N,N-dimethylpyrimidine-2-carboxamide |
| SMILES | CN(C)C(=O)c1nccc(N)n1 |
| InChI | InChI=1S/C7H10N4O/c1-11(2)7(12)6-9-4-3-5(8)10-6/h3-4H,1-2H3,(H2,8,9,10) |
| InChIKey | MOWJORAUCZUASO-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-amino-N,N-dimethylpyrimidine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-N,N-dimethylpyrimidine-2-carboxamide?
The IUPAC name of 4-amino-N,N-dimethylpyrimidine-2-carboxamide (CID 117212988) is 4-amino-N,N-dimethylpyrimidine-2-carboxamide.
What is the SMILES notation for 4-amino-N,N-dimethylpyrimidine-2-carboxamide?
The canonical SMILES for 4-amino-N,N-dimethylpyrimidine-2-carboxamide is CN(C)C(=O)c1nccc(N)n1.
What is the InChIKey of 4-amino-N,N-dimethylpyrimidine-2-carboxamide?
The InChIKey is MOWJORAUCZUASO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N4O/c1-11(2)7(12)6-9-4-3-5(8)10-6/h3-4H,1-2H3,(H2,8,9,10).
What are the key properties of 4-amino-N,N-dimethylpyrimidine-2-carboxamide?
4-amino-N,N-dimethylpyrimidine-2-carboxamide has a molecular weight of 166.18 g/mol, XLogP of -0.24, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-N,N-dimethylpyrimidine-2-carboxamide is sourced from PubChem (CID 117212988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).