C7H10N2O5S2 — CID 117213412
(5-amino-1,1-dioxo-1,2-thiazol-4-yl)-propan-2-ylsulfonylmethanone (PubChem CID 117213412) has the molecular formula C7H10N2O5S2 and a molecular weight of 266.30 g/mol. Its IUPAC name is (5-amino-1,1-dioxo-1,2-thiazol-4-yl)-propan-2-ylsulfonylmethanone.
| Compound Name | (5-amino-1,1-dioxo-1,2-thiazol-4-yl)-propan-2-ylsulfonylmethanone |
|---|---|
| PubChem CID | 117213412 |
| Molecular Formula | C7H10N2O5S2 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.00 |
| IUPAC Name | (5-amino-1,1-dioxo-1,2-thiazol-4-yl)-propan-2-ylsulfonylmethanone |
| SMILES | CC(C)S(=O)(=O)C(=O)C1=C(N)S(=O)(=O)N=C1 |
| InChI | InChI=1S/C7H10N2O5S2/c1-4(2)15(11,12)7(10)5-3-9-16(13,14)6(5)8/h3-4H,8H2,1-2H3 |
| InChIKey | VLVHZXMAMWTBQQ-UHFFFAOYSA-N |
| XLogP | -1.08 |
| TPSA | 123.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|