C11H7F3N2O3S — CID 117214376
4-[[4-(trifluoromethyl)phenoxy]methyl]thiadiazole-5-carboxylic acid (PubChem CID 117214376) has the molecular formula C11H7F3N2O3S and a molecular weight of 304.25 g/mol. Its IUPAC name is 4-[[4-(trifluoromethyl)phenoxy]methyl]thiadiazole-5-carboxylic acid.
| Compound Name | 4-[[4-(trifluoromethyl)phenoxy]methyl]thiadiazole-5-carboxylic acid |
|---|---|
| PubChem CID | 117214376 |
| Molecular Formula | C11H7F3N2O3S |
| Molecular Weight | 304.25 g/mol |
| Exact Mass | 304.01 |
| IUPAC Name | 4-[[4-(trifluoromethyl)phenoxy]methyl]thiadiazole-5-carboxylic acid |
| SMILES | O=C(O)c1snnc1COc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C11H7F3N2O3S/c12-11(13,14)6-1-3-7(4-2-6)19-5-8-9(10(17)18)20-16-15-8/h1-4H,5H2,(H,17,18) |
| InChIKey | CKDGUYABLJPGJT-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.25 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |