C7H11N3O2S — CID 117214602
5-[(propan-2-ylamino)methyl]thiadiazole-4-carboxylic acid (PubChem CID 117214602) has the molecular formula C7H11N3O2S and a molecular weight of 201.25 g/mol. Its IUPAC name is 5-[(propan-2-ylamino)methyl]thiadiazole-4-carboxylic acid.
| Compound Name | 5-[(propan-2-ylamino)methyl]thiadiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 117214602 |
| Molecular Formula | C7H11N3O2S |
| Molecular Weight | 201.25 g/mol |
| Exact Mass | 201.06 |
| IUPAC Name | 5-[(propan-2-ylamino)methyl]thiadiazole-4-carboxylic acid |
| SMILES | CC(C)NCc1snnc1C(=O)O |
| InChI | InChI=1S/C7H11N3O2S/c1-4(2)8-3-5-6(7(11)12)9-10-13-5/h4,8H,3H2,1-2H3,(H,11,12) |
| InChIKey | REWOAFFRVRDFPA-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.25 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |