3-carbamoyl-1,2-thiazole-5-carboxylic acid

C5H4N2O3S — CID 117215211

IUPAC3-carbamoyl-1,2-thiazole-5-carboxylic acid
SMILESNC(=O)c1cc(C(=O)O)sn1
InChIInChI=1S/C5H4N2O3S/c6-4(8)2-1-3(5(9)10)11-7-2/h1H,(H2,6,8)(H,9,10)
InChIKeyRKYYUZCHWNBVNH-UHFFFAOYSA-N
MW172.17 g/mol
LogP-0.06
Rot. Bonds2

About 3-carbamoyl-1,2-thiazole-5-carboxylic acid

3-carbamoyl-1,2-thiazole-5-carboxylic acid (PubChem CID 117215211) has the molecular formula C5H4N2O3S and a molecular weight of 172.17 g/mol. Its IUPAC name is 3-carbamoyl-1,2-thiazole-5-carboxylic acid.

Molecular Properties

Compound Name3-carbamoyl-1,2-thiazole-5-carboxylic acid
PubChem CID117215211
Molecular FormulaC5H4N2O3S
Molecular Weight172.17 g/mol
Exact Mass171.99
IUPAC Name3-carbamoyl-1,2-thiazole-5-carboxylic acid
SMILESNC(=O)c1cc(C(=O)O)sn1
InChIInChI=1S/C5H4N2O3S/c6-4(8)2-1-3(5(9)10)11-7-2/h1H,(H2,6,8)(H,9,10)
InChIKeyRKYYUZCHWNBVNH-UHFFFAOYSA-N
XLogP-0.06
TPSA93.28 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500172.17
LogP ≤ 5-0.06
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 3-carbamoyl-1,2-thiazole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-carbamoyl-1,2-thiazole-5-carboxylic acid?
The IUPAC name of 3-carbamoyl-1,2-thiazole-5-carboxylic acid (CID 117215211) is 3-carbamoyl-1,2-thiazole-5-carboxylic acid.
What is the SMILES notation for 3-carbamoyl-1,2-thiazole-5-carboxylic acid?
The canonical SMILES for 3-carbamoyl-1,2-thiazole-5-carboxylic acid is NC(=O)c1cc(C(=O)O)sn1.
What is the InChIKey of 3-carbamoyl-1,2-thiazole-5-carboxylic acid?
The InChIKey is RKYYUZCHWNBVNH-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4N2O3S/c6-4(8)2-1-3(5(9)10)11-7-2/h1H,(H2,6,8)(H,9,10).
What are the key properties of 3-carbamoyl-1,2-thiazole-5-carboxylic acid?
3-carbamoyl-1,2-thiazole-5-carboxylic acid has a molecular weight of 172.17 g/mol, XLogP of -0.06, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-carbamoyl-1,2-thiazole-5-carboxylic acid is sourced from PubChem (CID 117215211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).