About 3-(ethylcarbamoyl)-1,2-thiazole-5-carboxylic acid
3-(ethylcarbamoyl)-1,2-thiazole-5-carboxylic acid (PubChem CID 117215245) has the molecular formula C7H8N2O3S
and a molecular weight of 200.22 g/mol. Its IUPAC name is 3-(ethylcarbamoyl)-1,2-thiazole-5-carboxylic acid.
Molecular Properties
| Compound Name | 3-(ethylcarbamoyl)-1,2-thiazole-5-carboxylic acid |
| PubChem CID | 117215245 |
| Molecular Formula | C7H8N2O3S |
| Molecular Weight | 200.22 g/mol |
| Exact Mass | 200.03 |
| IUPAC Name | 3-(ethylcarbamoyl)-1,2-thiazole-5-carboxylic acid |
| SMILES | CCNC(=O)c1cc(C(=O)O)sn1 |
| InChI | InChI=1S/C7H8N2O3S/c1-2-8-6(10)4-3-5(7(11)12)13-9-4/h3H,2H2,1H3,(H,8,10)(H,11,12) |
| InChIKey | HBPKEWRIEGJYFP-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.22 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(ethylcarbamoyl)-1,2-thiazole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(ethylcarbamoyl)-1,2-thiazole-5-carboxylic acid?
The IUPAC name of 3-(ethylcarbamoyl)-1,2-thiazole-5-carboxylic acid (CID 117215245) is 3-(ethylcarbamoyl)-1,2-thiazole-5-carboxylic acid.
What is the SMILES notation for 3-(ethylcarbamoyl)-1,2-thiazole-5-carboxylic acid?
The canonical SMILES for 3-(ethylcarbamoyl)-1,2-thiazole-5-carboxylic acid is CCNC(=O)c1cc(C(=O)O)sn1.
What is the InChIKey of 3-(ethylcarbamoyl)-1,2-thiazole-5-carboxylic acid?
The InChIKey is HBPKEWRIEGJYFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O3S/c1-2-8-6(10)4-3-5(7(11)12)13-9-4/h3H,2H2,1H3,(H,8,10)(H,11,12).
What are the key properties of 3-(ethylcarbamoyl)-1,2-thiazole-5-carboxylic acid?
3-(ethylcarbamoyl)-1,2-thiazole-5-carboxylic acid has a molecular weight of 200.22 g/mol, XLogP of 0.59, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(ethylcarbamoyl)-1,2-thiazole-5-carboxylic acid is sourced from PubChem (CID 117215245), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).