3-(propan-2-ylcarbamoyl)-1,2-thiazole-5-carboxylic acid

C8H10N2O3S — CID 117215248

IUPAC3-(propan-2-ylcarbamoyl)-1,2-thiazole-5-carboxylic acid
SMILESCC(C)NC(=O)c1cc(C(=O)O)sn1
InChIInChI=1S/C8H10N2O3S/c1-4(2)9-7(11)5-3-6(8(12)13)14-10-5/h3-4H,1-2H3,(H,9,11)(H,12,13)
InChIKeyATJWLEUTYVFKRE-UHFFFAOYSA-N
MW214.25 g/mol
LogP0.98
Rot. Bonds3

About 3-(propan-2-ylcarbamoyl)-1,2-thiazole-5-carboxylic acid

3-(propan-2-ylcarbamoyl)-1,2-thiazole-5-carboxylic acid (PubChem CID 117215248) has the molecular formula C8H10N2O3S and a molecular weight of 214.25 g/mol. Its IUPAC name is 3-(propan-2-ylcarbamoyl)-1,2-thiazole-5-carboxylic acid.

Molecular Properties

Compound Name3-(propan-2-ylcarbamoyl)-1,2-thiazole-5-carboxylic acid
PubChem CID117215248
Molecular FormulaC8H10N2O3S
Molecular Weight214.25 g/mol
Exact Mass214.04
IUPAC Name3-(propan-2-ylcarbamoyl)-1,2-thiazole-5-carboxylic acid
SMILESCC(C)NC(=O)c1cc(C(=O)O)sn1
InChIInChI=1S/C8H10N2O3S/c1-4(2)9-7(11)5-3-6(8(12)13)14-10-5/h3-4H,1-2H3,(H,9,11)(H,12,13)
InChIKeyATJWLEUTYVFKRE-UHFFFAOYSA-N
XLogP0.98
TPSA79.29 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500214.25
LogP ≤ 50.98
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 3-(propan-2-ylcarbamoyl)-1,2-thiazole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(propan-2-ylcarbamoyl)-1,2-thiazole-5-carboxylic acid?
The IUPAC name of 3-(propan-2-ylcarbamoyl)-1,2-thiazole-5-carboxylic acid (CID 117215248) is 3-(propan-2-ylcarbamoyl)-1,2-thiazole-5-carboxylic acid.
What is the SMILES notation for 3-(propan-2-ylcarbamoyl)-1,2-thiazole-5-carboxylic acid?
The canonical SMILES for 3-(propan-2-ylcarbamoyl)-1,2-thiazole-5-carboxylic acid is CC(C)NC(=O)c1cc(C(=O)O)sn1.
What is the InChIKey of 3-(propan-2-ylcarbamoyl)-1,2-thiazole-5-carboxylic acid?
The InChIKey is ATJWLEUTYVFKRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O3S/c1-4(2)9-7(11)5-3-6(8(12)13)14-10-5/h3-4H,1-2H3,(H,9,11)(H,12,13).
What are the key properties of 3-(propan-2-ylcarbamoyl)-1,2-thiazole-5-carboxylic acid?
3-(propan-2-ylcarbamoyl)-1,2-thiazole-5-carboxylic acid has a molecular weight of 214.25 g/mol, XLogP of 0.98, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(propan-2-ylcarbamoyl)-1,2-thiazole-5-carboxylic acid is sourced from PubChem (CID 117215248), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).