C6H8N2O2S — CID 117215995
1-methyl-3-(sulfanylmethyl)pyrazole-5-carboxylic acid (PubChem CID 117215995) has the molecular formula C6H8N2O2S and a molecular weight of 172.21 g/mol. Its IUPAC name is 1-methyl-3-(sulfanylmethyl)pyrazole-5-carboxylic acid.
| Compound Name | 1-methyl-3-(sulfanylmethyl)pyrazole-5-carboxylic acid |
|---|---|
| PubChem CID | 117215995 |
| Molecular Formula | C6H8N2O2S |
| Molecular Weight | 172.21 g/mol |
| Exact Mass | 172.03 |
| IUPAC Name | 1-methyl-3-(sulfanylmethyl)pyrazole-5-carboxylic acid |
| SMILES | Cn1nc(CS)cc1C(=O)O |
| InChI | InChI=1S/C6H8N2O2S/c1-8-5(6(9)10)2-4(3-11)7-8/h2,11H,3H2,1H3,(H,9,10) |
| InChIKey | DYRHWYRBTHGIPQ-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.21 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|