C9H14N2O4S — CID 117216809
4-(methylsulfonylmethyl)-1-propan-2-ylpyrazole-5-carboxylic acid (PubChem CID 117216809) has the molecular formula C9H14N2O4S and a molecular weight of 246.29 g/mol. Its IUPAC name is 4-(methylsulfonylmethyl)-1-propan-2-ylpyrazole-5-carboxylic acid.
| Compound Name | 4-(methylsulfonylmethyl)-1-propan-2-ylpyrazole-5-carboxylic acid |
|---|---|
| PubChem CID | 117216809 |
| Molecular Formula | C9H14N2O4S |
| Molecular Weight | 246.29 g/mol |
| Exact Mass | 246.07 |
| IUPAC Name | 4-(methylsulfonylmethyl)-1-propan-2-ylpyrazole-5-carboxylic acid |
| SMILES | CC(C)n1ncc(CS(C)(=O)=O)c1C(=O)O |
| InChI | InChI=1S/C9H14N2O4S/c1-6(2)11-8(9(12)13)7(4-10-11)5-16(3,14)15/h4,6H,5H2,1-3H3,(H,12,13) |
| InChIKey | ZHHAGNFICLLTTC-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.29 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |