C10H9BrN2O2 — CID 117216893
5-[(3-bromophenoxy)methyl]-1,2-oxazol-3-amine (PubChem CID 117216893) has the molecular formula C10H9BrN2O2 and a molecular weight of 269.10 g/mol. Its IUPAC name is 5-[(3-bromophenoxy)methyl]-1,2-oxazol-3-amine.
| Compound Name | 5-[(3-bromophenoxy)methyl]-1,2-oxazol-3-amine |
|---|---|
| PubChem CID | 117216893 |
| Molecular Formula | C10H9BrN2O2 |
| Molecular Weight | 269.10 g/mol |
| Exact Mass | 267.98 |
| IUPAC Name | 5-[(3-bromophenoxy)methyl]-1,2-oxazol-3-amine |
| SMILES | Nc1cc(COc2cccc(Br)c2)on1 |
| InChI | InChI=1S/C10H9BrN2O2/c11-7-2-1-3-8(4-7)14-6-9-5-10(12)13-15-9/h1-5H,6H2,(H2,12,13) |
| InChIKey | ZCUSKIKTFUYDQZ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.10 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |