5-methoxycarbonyl-1,2-thiazole-3-carboxylic acid

C6H5NO4S — CID 117218321

IUPAC5-methoxycarbonyl-1,2-thiazole-3-carboxylic acid
SMILESCOC(=O)c1cc(C(=O)O)ns1
InChIInChI=1S/C6H5NO4S/c1-11-6(10)4-2-3(5(8)9)7-12-4/h2H,1H3,(H,8,9)
InChIKeyUHLLTSXSWXNRNY-UHFFFAOYSA-N
MW187.18 g/mol
LogP0.63
Rot. Bonds2

About 5-methoxycarbonyl-1,2-thiazole-3-carboxylic acid

5-methoxycarbonyl-1,2-thiazole-3-carboxylic acid (PubChem CID 117218321) has the molecular formula C6H5NO4S and a molecular weight of 187.18 g/mol. Its IUPAC name is 5-methoxycarbonyl-1,2-thiazole-3-carboxylic acid.

Molecular Properties

Compound Name5-methoxycarbonyl-1,2-thiazole-3-carboxylic acid
PubChem CID117218321
Molecular FormulaC6H5NO4S
Molecular Weight187.18 g/mol
Exact Mass186.99
IUPAC Name5-methoxycarbonyl-1,2-thiazole-3-carboxylic acid
SMILESCOC(=O)c1cc(C(=O)O)ns1
InChIInChI=1S/C6H5NO4S/c1-11-6(10)4-2-3(5(8)9)7-12-4/h2H,1H3,(H,8,9)
InChIKeyUHLLTSXSWXNRNY-UHFFFAOYSA-N
XLogP0.63
TPSA76.49 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500187.18
LogP ≤ 50.63
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 5-methoxycarbonyl-1,2-thiazole-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-methoxycarbonyl-1,2-thiazole-3-carboxylic acid?
The IUPAC name of 5-methoxycarbonyl-1,2-thiazole-3-carboxylic acid (CID 117218321) is 5-methoxycarbonyl-1,2-thiazole-3-carboxylic acid.
What is the SMILES notation for 5-methoxycarbonyl-1,2-thiazole-3-carboxylic acid?
The canonical SMILES for 5-methoxycarbonyl-1,2-thiazole-3-carboxylic acid is COC(=O)c1cc(C(=O)O)ns1.
What is the InChIKey of 5-methoxycarbonyl-1,2-thiazole-3-carboxylic acid?
The InChIKey is UHLLTSXSWXNRNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5NO4S/c1-11-6(10)4-2-3(5(8)9)7-12-4/h2H,1H3,(H,8,9).
What are the key properties of 5-methoxycarbonyl-1,2-thiazole-3-carboxylic acid?
5-methoxycarbonyl-1,2-thiazole-3-carboxylic acid has a molecular weight of 187.18 g/mol, XLogP of 0.63, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxycarbonyl-1,2-thiazole-3-carboxylic acid is sourced from PubChem (CID 117218321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).