About S-methyl 4-amino-1,1-dioxo-1,2-thiazole-5-carbothioate
S-methyl 4-amino-1,1-dioxo-1,2-thiazole-5-carbothioate (PubChem CID 117218779) has the molecular formula C5H6N2O3S2
and a molecular weight of 206.25 g/mol. Its IUPAC name is S-methyl 4-amino-1,1-dioxo-1,2-thiazole-5-carbothioate.
Molecular Properties
| Compound Name | S-methyl 4-amino-1,1-dioxo-1,2-thiazole-5-carbothioate |
| PubChem CID | 117218779 |
| Molecular Formula | C5H6N2O3S2 |
| Molecular Weight | 206.25 g/mol |
| Exact Mass | 205.98 |
| IUPAC Name | S-methyl 4-amino-1,1-dioxo-1,2-thiazole-5-carbothioate |
| SMILES | CSC(=O)C1=C(N)C=NS1(=O)=O |
| InChI | InChI=1S/C5H6N2O3S2/c1-11-5(8)4-3(6)2-7-12(4,9)10/h2H,6H2,1H3 |
| InChIKey | FLEBXXRNDGAEAH-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 89.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.25 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-methyl 4-amino-1,1-dioxo-1,2-thiazole-5-carbothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-methyl 4-amino-1,1-dioxo-1,2-thiazole-5-carbothioate?
The IUPAC name of S-methyl 4-amino-1,1-dioxo-1,2-thiazole-5-carbothioate (CID 117218779) is S-methyl 4-amino-1,1-dioxo-1,2-thiazole-5-carbothioate.
What is the SMILES notation for S-methyl 4-amino-1,1-dioxo-1,2-thiazole-5-carbothioate?
The canonical SMILES for S-methyl 4-amino-1,1-dioxo-1,2-thiazole-5-carbothioate is CSC(=O)C1=C(N)C=NS1(=O)=O.
What is the InChIKey of S-methyl 4-amino-1,1-dioxo-1,2-thiazole-5-carbothioate?
The InChIKey is FLEBXXRNDGAEAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6N2O3S2/c1-11-5(8)4-3(6)2-7-12(4,9)10/h2H,6H2,1H3.
What are the key properties of S-methyl 4-amino-1,1-dioxo-1,2-thiazole-5-carbothioate?
S-methyl 4-amino-1,1-dioxo-1,2-thiazole-5-carbothioate has a molecular weight of 206.25 g/mol, XLogP of -0.54, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for S-methyl 4-amino-1,1-dioxo-1,2-thiazole-5-carbothioate is sourced from PubChem (CID 117218779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).