About CID 11721972
CID 11721972 (PubChem CID 11721972) has the molecular formula C44H67Cl2N2PRu
and a molecular weight of 826.98 g/mol.
Molecular Properties
| Compound Name | CID 11721972 |
| PubChem CID | 11721972 |
| Molecular Formula | C44H67Cl2N2PRu |
| Molecular Weight | 826.98 g/mol |
| Exact Mass | 826.35 |
| IUPAC Name | — |
| SMILES | C1CCC(P(C2CCCCC2)C2CCCCC2)CC1.CC(C)=CC=[Ru](Cl)Cl.Cc1cc(C)c(N2[C]N(c3c(C)cc(C)cc3C)CC2)c(C)c1 |
| InChI | InChI=1S/C21H26N2.C18H33P.C5H8.2ClH.Ru/c1-14-9-16(3)20(17(4)10-14)22-7-8-23(13-22)21-18(5)11-15(2)12-19(21)6;1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-4-5(2)3;;;/h9-12H,7-8H2,1-6H3;16-18H,1-15H2;1,4H,2-3H3;2*1H;/q;;;;;+2/p-2 |
| InChIKey | LCOFYVWULBZOTA-UHFFFAOYSA-L |
| XLogP | 14.01 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 826.98 |
| LogP ≤ 5 | 14.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 11721972 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 11721972?
The IUPAC name of CID 11721972 (CID 11721972) is not available.
What is the SMILES notation for CID 11721972?
The canonical SMILES for CID 11721972 is C1CCC(P(C2CCCCC2)C2CCCCC2)CC1.CC(C)=CC=[Ru](Cl)Cl.Cc1cc(C)c(N2[C]N(c3c(C)cc(C)cc3C)CC2)c(C)c1.
What is the InChIKey of CID 11721972?
The InChIKey is LCOFYVWULBZOTA-UHFFFAOYSA-L. The full InChI is InChI=1S/C21H26N2.C18H33P.C5H8.2ClH.Ru/c1-14-9-16(3)20(17(4)10-14)22-7-8-23(13-22)21-18(5)11-15(2)12-19(21)6;1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-4-5(2)3;;;/h9-12H,7-8H2,1-6H3;16-18H,1-15H2;1,4H,2-3H3;2*1H;/q;;;;;+2/p-2.
What are the key properties of CID 11721972?
CID 11721972 has a molecular weight of 826.98 g/mol, XLogP of 14.01, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 11721972 is sourced from PubChem (CID 11721972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).