C12H11NO3 — CID 117219782
4-(pyridin-3-yloxymethyl)benzene-1,3-diol (PubChem CID 117219782) has the molecular formula C12H11NO3 and a molecular weight of 217.22 g/mol. Its IUPAC name is 4-(pyridin-3-yloxymethyl)benzene-1,3-diol.
| Compound Name | 4-(pyridin-3-yloxymethyl)benzene-1,3-diol |
|---|---|
| PubChem CID | 117219782 |
| Molecular Formula | C12H11NO3 |
| Molecular Weight | 217.22 g/mol |
| Exact Mass | 217.07 |
| IUPAC Name | 4-(pyridin-3-yloxymethyl)benzene-1,3-diol |
| SMILES | Oc1ccc(COc2cccnc2)c(O)c1 |
| InChI | InChI=1S/C12H11NO3/c14-10-4-3-9(12(15)6-10)8-16-11-2-1-5-13-7-11/h1-7,14-15H,8H2 |
| InChIKey | WHMUCBODAZEZRW-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 62.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.22 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |