C12H16BrNO — CID 117219999
N-[(4-bromo-3-methoxyphenyl)methyl]cyclobutanamine (PubChem CID 117219999) has the molecular formula C12H16BrNO and a molecular weight of 270.17 g/mol. Its IUPAC name is N-[(4-bromo-3-methoxyphenyl)methyl]cyclobutanamine.
| Compound Name | N-[(4-bromo-3-methoxyphenyl)methyl]cyclobutanamine |
|---|---|
| PubChem CID | 117219999 |
| Molecular Formula | C12H16BrNO |
| Molecular Weight | 270.17 g/mol |
| Exact Mass | 269.04 |
| IUPAC Name | N-[(4-bromo-3-methoxyphenyl)methyl]cyclobutanamine |
| SMILES | COc1cc(CNC2CCC2)ccc1Br |
| InChI | InChI=1S/C12H16BrNO/c1-15-12-7-9(5-6-11(12)13)8-14-10-3-2-4-10/h5-7,10,14H,2-4,8H2,1H3 |
| InChIKey | YMAAITREVYVSHN-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.17 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |