C24H25F7N2O4S — CID 11722194
1-N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methylphenyl]-3-methyl-2-N-(2-methyl-1-methylsulfonylpropan-2-yl)benzene-1,2-dicarboxamide (PubChem CID 11722194) has the molecular formula C24H25F7N2O4S and a molecular weight of 570.53 g/mol. Its IUPAC name is 1-N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methylphenyl]-3-methyl-2-N-(2-methyl-1-methylsulfonylpropan-2-yl)benzene-1,2-dicarboxamide.
| Compound Name | 1-N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methylphenyl]-3-methyl-2-N-(2-methyl-1-methylsulfonylpropan-2-yl)benzene-1,2-dicarboxamide |
|---|---|
| PubChem CID | 11722194 |
| Molecular Formula | C24H25F7N2O4S |
| Molecular Weight | 570.53 g/mol |
| Exact Mass | 570.14 |
| IUPAC Name | 1-N-[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2-methylphenyl]-3-methyl-2-N-(2-methyl-1-methylsulfonylpropan-2-yl)benzene-1,2-dicarboxamide |
| SMILES | Cc1cc(C(F)(C(F)(F)F)C(F)(F)F)ccc1NC(=O)c1cccc(C)c1C(=O)NC(C)(C)CS(C)(=O)=O |
| InChI | InChI=1S/C24H25F7N2O4S/c1-13-7-6-8-16(18(13)20(35)33-21(3,4)12-38(5,36)37)19(34)32-17-10-9-15(11-14(17)2)22(25,23(26,27)28)24(29,30)31/h6-11H,12H2,1-5H3,(H,32,34)(H,33,35) |
| InChIKey | ONIPIIZHPUZFBY-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.53 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |