C15H14F3NO2 — CID 117222539
1-propan-2-yl-3-[2-(trifluoromethyl)phenyl]pyrrole-2-carboxylic acid (PubChem CID 117222539) has the molecular formula C15H14F3NO2 and a molecular weight of 297.28 g/mol. Its IUPAC name is 1-propan-2-yl-3-[2-(trifluoromethyl)phenyl]pyrrole-2-carboxylic acid.
| Compound Name | 1-propan-2-yl-3-[2-(trifluoromethyl)phenyl]pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 117222539 |
| Molecular Formula | C15H14F3NO2 |
| Molecular Weight | 297.28 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | 1-propan-2-yl-3-[2-(trifluoromethyl)phenyl]pyrrole-2-carboxylic acid |
| SMILES | CC(C)n1ccc(-c2ccccc2C(F)(F)F)c1C(=O)O |
| InChI | InChI=1S/C15H14F3NO2/c1-9(2)19-8-7-11(13(19)14(20)21)10-5-3-4-6-12(10)15(16,17)18/h3-9H,1-2H3,(H,20,21) |
| InChIKey | XSJVZPPFIJYUOE-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.28 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |