C12H10O5S — CID 117223020
3-(3-methoxyphenyl)-1,1-dioxothiophene-2-carboxylic acid (PubChem CID 117223020) has the molecular formula C12H10O5S and a molecular weight of 266.27 g/mol. Its IUPAC name is 3-(3-methoxyphenyl)-1,1-dioxothiophene-2-carboxylic acid.
| Compound Name | 3-(3-methoxyphenyl)-1,1-dioxothiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 117223020 |
| Molecular Formula | C12H10O5S |
| Molecular Weight | 266.27 g/mol |
| Exact Mass | 266.02 |
| IUPAC Name | 3-(3-methoxyphenyl)-1,1-dioxothiophene-2-carboxylic acid |
| SMILES | COc1cccc(C2=C(C(=O)O)S(=O)(=O)C=C2)c1 |
| InChI | InChI=1S/C12H10O5S/c1-17-9-4-2-3-8(7-9)10-5-6-18(15,16)11(10)12(13)14/h2-7H,1H3,(H,13,14) |
| InChIKey | DGPOVUDBEDDVKV-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.27 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |