C18H20O4 — CID 11722329
2,2,4-trimethyl-6-(3-phenylpropanoyl)cyclohexane-1,3,5-trione (PubChem CID 11722329) has the molecular formula C18H20O4 and a molecular weight of 300.35 g/mol. Its IUPAC name is 2,2,4-trimethyl-6-(3-phenylpropanoyl)cyclohexane-1,3,5-trione.
| Compound Name | 2,2,4-trimethyl-6-(3-phenylpropanoyl)cyclohexane-1,3,5-trione |
|---|---|
| PubChem CID | 11722329 |
| Molecular Formula | C18H20O4 |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | 2,2,4-trimethyl-6-(3-phenylpropanoyl)cyclohexane-1,3,5-trione |
| SMILES | CC1C(=O)C(C(=O)CCc2ccccc2)C(=O)C(C)(C)C1=O |
| InChI | InChI=1S/C18H20O4/c1-11-15(20)14(17(22)18(2,3)16(11)21)13(19)10-9-12-7-5-4-6-8-12/h4-8,11,14H,9-10H2,1-3H3 |
| InChIKey | CTSXBYQFSBUGKB-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|