About 2-(5-chloropyrrolo[2,3-b]pyridin-1-yl)-N-methylethanamine
2-(5-chloropyrrolo[2,3-b]pyridin-1-yl)-N-methylethanamine (PubChem CID 117223833) has the molecular formula C10H12ClN3
and a molecular weight of 209.68 g/mol. Its IUPAC name is 2-(5-chloropyrrolo[2,3-b]pyridin-1-yl)-N-methylethanamine.
Molecular Properties
| Compound Name | 2-(5-chloropyrrolo[2,3-b]pyridin-1-yl)-N-methylethanamine |
| PubChem CID | 117223833 |
| Molecular Formula | C10H12ClN3 |
| Molecular Weight | 209.68 g/mol |
| Exact Mass | 209.07 |
| IUPAC Name | 2-(5-chloropyrrolo[2,3-b]pyridin-1-yl)-N-methylethanamine |
| SMILES | CNCCn1ccc2cc(Cl)cnc21 |
| InChI | InChI=1S/C10H12ClN3/c1-12-3-5-14-4-2-8-6-9(11)7-13-10(8)14/h2,4,6-7,12H,3,5H2,1H3 |
| InChIKey | ANHFPUCSILHDSV-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.68 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(5-chloropyrrolo[2,3-b]pyridin-1-yl)-N-methylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-chloropyrrolo[2,3-b]pyridin-1-yl)-N-methylethanamine?
The IUPAC name of 2-(5-chloropyrrolo[2,3-b]pyridin-1-yl)-N-methylethanamine (CID 117223833) is 2-(5-chloropyrrolo[2,3-b]pyridin-1-yl)-N-methylethanamine.
What is the SMILES notation for 2-(5-chloropyrrolo[2,3-b]pyridin-1-yl)-N-methylethanamine?
The canonical SMILES for 2-(5-chloropyrrolo[2,3-b]pyridin-1-yl)-N-methylethanamine is CNCCn1ccc2cc(Cl)cnc21.
What is the InChIKey of 2-(5-chloropyrrolo[2,3-b]pyridin-1-yl)-N-methylethanamine?
The InChIKey is ANHFPUCSILHDSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12ClN3/c1-12-3-5-14-4-2-8-6-9(11)7-13-10(8)14/h2,4,6-7,12H,3,5H2,1H3.
What are the key properties of 2-(5-chloropyrrolo[2,3-b]pyridin-1-yl)-N-methylethanamine?
2-(5-chloropyrrolo[2,3-b]pyridin-1-yl)-N-methylethanamine has a molecular weight of 209.68 g/mol, XLogP of 1.91, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-chloropyrrolo[2,3-b]pyridin-1-yl)-N-methylethanamine is sourced from PubChem (CID 117223833), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).