About 2-(5-bromopyrrolo[2,3-b]pyridin-1-yl)ethanamine
2-(5-bromopyrrolo[2,3-b]pyridin-1-yl)ethanamine (PubChem CID 117223836) has the molecular formula C9H10BrN3
and a molecular weight of 240.10 g/mol. Its IUPAC name is 2-(5-bromopyrrolo[2,3-b]pyridin-1-yl)ethanamine.
Molecular Properties
| Compound Name | 2-(5-bromopyrrolo[2,3-b]pyridin-1-yl)ethanamine |
| PubChem CID | 117223836 |
| Molecular Formula | C9H10BrN3 |
| Molecular Weight | 240.10 g/mol |
| Exact Mass | 239.01 |
| IUPAC Name | 2-(5-bromopyrrolo[2,3-b]pyridin-1-yl)ethanamine |
| SMILES | NCCn1ccc2cc(Br)cnc21 |
| InChI | InChI=1S/C9H10BrN3/c10-8-5-7-1-3-13(4-2-11)9(7)12-6-8/h1,3,5-6H,2,4,11H2 |
| InChIKey | RONFMALMGRETQO-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.10 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(5-bromopyrrolo[2,3-b]pyridin-1-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-bromopyrrolo[2,3-b]pyridin-1-yl)ethanamine?
The IUPAC name of 2-(5-bromopyrrolo[2,3-b]pyridin-1-yl)ethanamine (CID 117223836) is 2-(5-bromopyrrolo[2,3-b]pyridin-1-yl)ethanamine.
What is the SMILES notation for 2-(5-bromopyrrolo[2,3-b]pyridin-1-yl)ethanamine?
The canonical SMILES for 2-(5-bromopyrrolo[2,3-b]pyridin-1-yl)ethanamine is NCCn1ccc2cc(Br)cnc21.
What is the InChIKey of 2-(5-bromopyrrolo[2,3-b]pyridin-1-yl)ethanamine?
The InChIKey is RONFMALMGRETQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10BrN3/c10-8-5-7-1-3-13(4-2-11)9(7)12-6-8/h1,3,5-6H,2,4,11H2.
What are the key properties of 2-(5-bromopyrrolo[2,3-b]pyridin-1-yl)ethanamine?
2-(5-bromopyrrolo[2,3-b]pyridin-1-yl)ethanamine has a molecular weight of 240.10 g/mol, XLogP of 1.76, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-bromopyrrolo[2,3-b]pyridin-1-yl)ethanamine is sourced from PubChem (CID 117223836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).