C13H16BrN3 — CID 117223883
2-bromo-1-(piperidin-3-ylmethyl)pyrrolo[2,3-b]pyridine (PubChem CID 117223883) has the molecular formula C13H16BrN3 and a molecular weight of 294.20 g/mol. Its IUPAC name is 2-bromo-1-(piperidin-3-ylmethyl)pyrrolo[2,3-b]pyridine.
| Compound Name | 2-bromo-1-(piperidin-3-ylmethyl)pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 117223883 |
| Molecular Formula | C13H16BrN3 |
| Molecular Weight | 294.20 g/mol |
| Exact Mass | 293.05 |
| IUPAC Name | 2-bromo-1-(piperidin-3-ylmethyl)pyrrolo[2,3-b]pyridine |
| SMILES | Brc1cc2cccnc2n1CC1CCCNC1 |
| InChI | InChI=1S/C13H16BrN3/c14-12-7-11-4-2-6-16-13(11)17(12)9-10-3-1-5-15-8-10/h2,4,6-7,10,15H,1,3,5,8-9H2 |
| InChIKey | UGDCXSJMNJXTEJ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.20 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |