C15H14N2O3S — CID 11722451
2-benzyl-1,1-dioxo-3,5-dihydro-1λ6,2,5-benzothiadiazepin-4-one (PubChem CID 11722451) has the molecular formula C15H14N2O3S and a molecular weight of 302.36 g/mol. Its IUPAC name is 2-benzyl-1,1-dioxo-3,5-dihydro-1λ6,2,5-benzothiadiazepin-4-one.
| Compound Name | 2-benzyl-1,1-dioxo-3,5-dihydro-1λ6,2,5-benzothiadiazepin-4-one |
|---|---|
| PubChem CID | 11722451 |
| Molecular Formula | C15H14N2O3S |
| Molecular Weight | 302.36 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | 2-benzyl-1,1-dioxo-3,5-dihydro-1λ6,2,5-benzothiadiazepin-4-one |
| SMILES | O=C1CN(Cc2ccccc2)S(=O)(=O)c2ccccc2N1 |
| InChI | InChI=1S/C15H14N2O3S/c18-15-11-17(10-12-6-2-1-3-7-12)21(19,20)14-9-5-4-8-13(14)16-15/h1-9H,10-11H2,(H,16,18) |
| InChIKey | ASPKTPVXZFYGGH-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.36 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |