C19H28O3 — CID 11722586
(4S,4aS,7E,11aR)-4-[(Z)-5-hydroxypent-3-enyl]-7-methyl-11-methylidene-1,4,4a,5,6,9,10,11a-octahydrocyclonona[c]pyran-3-one (PubChem CID 11722586) has the molecular formula C19H28O3 and a molecular weight of 304.43 g/mol. Its IUPAC name is (4S,4aS,7E,11aR)-4-[(Z)-5-hydroxypent-3-enyl]-7-methyl-11-methylidene-1,4,4a,5,6,9,10,11a-octahydrocyclonona[c]pyran-3-one.
| Compound Name | (4S,4aS,7E,11aR)-4-[(Z)-5-hydroxypent-3-enyl]-7-methyl-11-methylidene-1,4,4a,5,6,9,10,11a-octahydrocyclonona[c]pyran-3-one |
|---|---|
| PubChem CID | 11722586 |
| Molecular Formula | C19H28O3 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | (4S,4aS,7E,11aR)-4-[(Z)-5-hydroxypent-3-enyl]-7-methyl-11-methylidene-1,4,4a,5,6,9,10,11a-octahydrocyclonona[c]pyran-3-one |
| SMILES | C=C1CC/C=C(\C)CC[C@@H]2[C@H](CC/C=C\CO)C(=O)OC[C@@H]12 |
| InChI | InChI=1S/C19H28O3/c1-14-7-6-8-15(2)18-13-22-19(21)17(16(18)11-10-14)9-4-3-5-12-20/h3,5,7,16-18,20H,2,4,6,8-13H2,1H3/b5-3-,14-7+/t16-,17+,18+/m1/s1 |
| InChIKey | XPGKNDIUGKZTKO-GJHLYATASA-N |
| XLogP | 3.80 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|