C16H28N6 — CID 11722590
8-[5-(diethylamino)pentyl]-N,2-dimethylpyrazolo[1,5-a][1,3,5]triazin-4-amine (PubChem CID 11722590) has the molecular formula C16H28N6 and a molecular weight of 304.44 g/mol. Its IUPAC name is 8-[5-(diethylamino)pentyl]-N,2-dimethylpyrazolo[1,5-a][1,3,5]triazin-4-amine.
| Compound Name | 8-[5-(diethylamino)pentyl]-N,2-dimethylpyrazolo[1,5-a][1,3,5]triazin-4-amine |
|---|---|
| PubChem CID | 11722590 |
| Molecular Formula | C16H28N6 |
| Molecular Weight | 304.44 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | 8-[5-(diethylamino)pentyl]-N,2-dimethylpyrazolo[1,5-a][1,3,5]triazin-4-amine |
| SMILES | CCN(CC)CCCCCc1cnn2c(NC)nc(C)nc12 |
| InChI | InChI=1S/C16H28N6/c1-5-21(6-2)11-9-7-8-10-14-12-18-22-15(14)19-13(3)20-16(22)17-4/h12H,5-11H2,1-4H3,(H,17,19,20) |
| InChIKey | MAMUOAXJZBXVJQ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 58.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.44 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|