C9H18N2O — CID 117225935
2-(1-methylpyrrolidin-2-yl)-1,3-oxazinane (PubChem CID 117225935) has the molecular formula C9H18N2O and a molecular weight of 170.26 g/mol. Its IUPAC name is 2-(1-methylpyrrolidin-2-yl)-1,3-oxazinane.
| Compound Name | 2-(1-methylpyrrolidin-2-yl)-1,3-oxazinane |
|---|---|
| PubChem CID | 117225935 |
| Molecular Formula | C9H18N2O |
| Molecular Weight | 170.26 g/mol |
| Exact Mass | 170.14 |
| IUPAC Name | 2-(1-methylpyrrolidin-2-yl)-1,3-oxazinane |
| SMILES | CN1CCCC1C1NCCCO1 |
| InChI | InChI=1S/C9H18N2O/c1-11-6-2-4-8(11)9-10-5-3-7-12-9/h8-10H,2-7H2,1H3 |
| InChIKey | DHSMBMSHRXDWSP-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.26 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |