C12H24ClNOS — CID 117226220
2,5,5-trimethyl-2-(thian-4-yl)-1,3-oxazinane;hydrochloride (PubChem CID 117226220) has the molecular formula C12H24ClNOS and a molecular weight of 265.85 g/mol. Its IUPAC name is 2,5,5-trimethyl-2-(thian-4-yl)-1,3-oxazinane;hydrochloride.
| Compound Name | 2,5,5-trimethyl-2-(thian-4-yl)-1,3-oxazinane;hydrochloride |
|---|---|
| PubChem CID | 117226220 |
| Molecular Formula | C12H24ClNOS |
| Molecular Weight | 265.85 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | 2,5,5-trimethyl-2-(thian-4-yl)-1,3-oxazinane;hydrochloride |
| SMILES | CC1(C)CNC(C)(C2CCSCC2)OC1.Cl |
| InChI | InChI=1S/C12H23NOS.ClH/c1-11(2)8-13-12(3,14-9-11)10-4-6-15-7-5-10;/h10,13H,4-9H2,1-3H3;1H |
| InChIKey | CVVYFJMUYDXZOV-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.85 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |