C22H27N — CID 11722654
3-[(Z)-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)ethenyl]aniline (PubChem CID 11722654) has the molecular formula C22H27N and a molecular weight of 305.47 g/mol. Its IUPAC name is 3-[(Z)-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)ethenyl]aniline.
| Compound Name | 3-[(Z)-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)ethenyl]aniline |
|---|---|
| PubChem CID | 11722654 |
| Molecular Formula | C22H27N |
| Molecular Weight | 305.47 g/mol |
| Exact Mass | 305.21 |
| IUPAC Name | 3-[(Z)-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)ethenyl]aniline |
| SMILES | CC1(C)CCC(C)(C)c2cc(/C=C\c3cccc(N)c3)ccc21 |
| InChI | InChI=1S/C22H27N/c1-21(2)12-13-22(3,4)20-15-17(10-11-19(20)21)9-8-16-6-5-7-18(23)14-16/h5-11,14-15H,12-13,23H2,1-4H3/b9-8- |
| InChIKey | ZBWJQQJPCVBEEV-HJWRWDBZSA-N |
| XLogP | 5.79 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.47 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|