About 6-benzyl-3,4-dimethyl-1-[(1R)-1-phenylethyl]-3,6-dihydro-2H-pyridine
6-benzyl-3,4-dimethyl-1-[(1R)-1-phenylethyl]-3,6-dihydro-2H-pyridine (PubChem CID 11722655) has the molecular formula C22H27N
and a molecular weight of 305.47 g/mol. Its IUPAC name is 6-benzyl-3,4-dimethyl-1-[(1R)-1-phenylethyl]-3,6-dihydro-2H-pyridine.
Molecular Properties
| Compound Name | 6-benzyl-3,4-dimethyl-1-[(1R)-1-phenylethyl]-3,6-dihydro-2H-pyridine |
| PubChem CID | 11722655 |
| Molecular Formula | C22H27N |
| Molecular Weight | 305.47 g/mol |
| Exact Mass | 305.21 |
| IUPAC Name | 6-benzyl-3,4-dimethyl-1-[(1R)-1-phenylethyl]-3,6-dihydro-2H-pyridine |
| SMILES | CC1=CC(Cc2ccccc2)N([C@H](C)c2ccccc2)CC1C |
| InChI | InChI=1S/C22H27N/c1-17-14-22(15-20-10-6-4-7-11-20)23(16-18(17)2)19(3)21-12-8-5-9-13-21/h4-14,18-19,22H,15-16H2,1-3H3/t18?,19-,22?/m1/s1 |
| InChIKey | ZHGFTOFAKNOXGW-GSVIPDFHSA-N |
| XLogP | 5.26 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 305.47 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-benzyl-3,4-dimethyl-1-[(1R)-1-phenylethyl]-3,6-dihydro-2H-pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-benzyl-3,4-dimethyl-1-[(1R)-1-phenylethyl]-3,6-dihydro-2H-pyridine?
The IUPAC name of 6-benzyl-3,4-dimethyl-1-[(1R)-1-phenylethyl]-3,6-dihydro-2H-pyridine (CID 11722655) is 6-benzyl-3,4-dimethyl-1-[(1R)-1-phenylethyl]-3,6-dihydro-2H-pyridine.
What is the SMILES notation for 6-benzyl-3,4-dimethyl-1-[(1R)-1-phenylethyl]-3,6-dihydro-2H-pyridine?
The canonical SMILES for 6-benzyl-3,4-dimethyl-1-[(1R)-1-phenylethyl]-3,6-dihydro-2H-pyridine is CC1=CC(Cc2ccccc2)N([C@H](C)c2ccccc2)CC1C.
What is the InChIKey of 6-benzyl-3,4-dimethyl-1-[(1R)-1-phenylethyl]-3,6-dihydro-2H-pyridine?
The InChIKey is ZHGFTOFAKNOXGW-GSVIPDFHSA-N. The full InChI is InChI=1S/C22H27N/c1-17-14-22(15-20-10-6-4-7-11-20)23(16-18(17)2)19(3)21-12-8-5-9-13-21/h4-14,18-19,22H,15-16H2,1-3H3/t18?,19-,22?/m1/s1.
What are the key properties of 6-benzyl-3,4-dimethyl-1-[(1R)-1-phenylethyl]-3,6-dihydro-2H-pyridine?
6-benzyl-3,4-dimethyl-1-[(1R)-1-phenylethyl]-3,6-dihydro-2H-pyridine has a molecular weight of 305.47 g/mol, XLogP of 5.26, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-benzyl-3,4-dimethyl-1-[(1R)-1-phenylethyl]-3,6-dihydro-2H-pyridine is sourced from PubChem (CID 11722655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).