About 3-[(5-methyl-1,3-oxazinan-2-yl)methyl]thiane 1,1-dioxide;hydrochloride
3-[(5-methyl-1,3-oxazinan-2-yl)methyl]thiane 1,1-dioxide;hydrochloride (PubChem CID 117226654) has the molecular formula C11H22ClNO3S
and a molecular weight of 283.82 g/mol. Its IUPAC name is 3-[(5-methyl-1,3-oxazinan-2-yl)methyl]thiane 1,1-dioxide;hydrochloride.
Molecular Properties
| Compound Name | 3-[(5-methyl-1,3-oxazinan-2-yl)methyl]thiane 1,1-dioxide;hydrochloride |
| PubChem CID | 117226654 |
| Molecular Formula | C11H22ClNO3S |
| Molecular Weight | 283.82 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | 3-[(5-methyl-1,3-oxazinan-2-yl)methyl]thiane 1,1-dioxide;hydrochloride |
| SMILES | CC1CNC(CC2CCCS(=O)(=O)C2)OC1.Cl |
| InChI | InChI=1S/C11H21NO3S.ClH/c1-9-6-12-11(15-7-9)5-10-3-2-4-16(13,14)8-10;/h9-12H,2-8H2,1H3;1H |
| InChIKey | PCXHMQGCEKMGKU-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.82 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[(5-methyl-1,3-oxazinan-2-yl)methyl]thiane 1,1-dioxide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(5-methyl-1,3-oxazinan-2-yl)methyl]thiane 1,1-dioxide;hydrochloride?
The IUPAC name of 3-[(5-methyl-1,3-oxazinan-2-yl)methyl]thiane 1,1-dioxide;hydrochloride (CID 117226654) is 3-[(5-methyl-1,3-oxazinan-2-yl)methyl]thiane 1,1-dioxide;hydrochloride.
What is the SMILES notation for 3-[(5-methyl-1,3-oxazinan-2-yl)methyl]thiane 1,1-dioxide;hydrochloride?
The canonical SMILES for 3-[(5-methyl-1,3-oxazinan-2-yl)methyl]thiane 1,1-dioxide;hydrochloride is CC1CNC(CC2CCCS(=O)(=O)C2)OC1.Cl.
What is the InChIKey of 3-[(5-methyl-1,3-oxazinan-2-yl)methyl]thiane 1,1-dioxide;hydrochloride?
The InChIKey is PCXHMQGCEKMGKU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NO3S.ClH/c1-9-6-12-11(15-7-9)5-10-3-2-4-16(13,14)8-10;/h9-12H,2-8H2,1H3;1H.
What are the key properties of 3-[(5-methyl-1,3-oxazinan-2-yl)methyl]thiane 1,1-dioxide;hydrochloride?
3-[(5-methyl-1,3-oxazinan-2-yl)methyl]thiane 1,1-dioxide;hydrochloride has a molecular weight of 283.82 g/mol, XLogP of 1.21, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(5-methyl-1,3-oxazinan-2-yl)methyl]thiane 1,1-dioxide;hydrochloride is sourced from PubChem (CID 117226654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).