About 5-methyl-2-(5-methylfuran-2-yl)-1,3-oxazinane
5-methyl-2-(5-methylfuran-2-yl)-1,3-oxazinane (PubChem CID 117226705) has the molecular formula C10H15NO2
and a molecular weight of 181.24 g/mol. Its IUPAC name is 5-methyl-2-(5-methylfuran-2-yl)-1,3-oxazinane.
Molecular Properties
| Compound Name | 5-methyl-2-(5-methylfuran-2-yl)-1,3-oxazinane |
| PubChem CID | 117226705 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | 5-methyl-2-(5-methylfuran-2-yl)-1,3-oxazinane |
| SMILES | Cc1ccc(C2NCC(C)CO2)o1 |
| InChI | InChI=1S/C10H15NO2/c1-7-5-11-10(12-6-7)9-4-3-8(2)13-9/h3-4,7,10-11H,5-6H2,1-2H3 |
| InChIKey | OGJCBVQBQBJMHK-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-methyl-2-(5-methylfuran-2-yl)-1,3-oxazinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-2-(5-methylfuran-2-yl)-1,3-oxazinane?
The IUPAC name of 5-methyl-2-(5-methylfuran-2-yl)-1,3-oxazinane (CID 117226705) is 5-methyl-2-(5-methylfuran-2-yl)-1,3-oxazinane.
What is the SMILES notation for 5-methyl-2-(5-methylfuran-2-yl)-1,3-oxazinane?
The canonical SMILES for 5-methyl-2-(5-methylfuran-2-yl)-1,3-oxazinane is Cc1ccc(C2NCC(C)CO2)o1.
What is the InChIKey of 5-methyl-2-(5-methylfuran-2-yl)-1,3-oxazinane?
The InChIKey is OGJCBVQBQBJMHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO2/c1-7-5-11-10(12-6-7)9-4-3-8(2)13-9/h3-4,7,10-11H,5-6H2,1-2H3.
What are the key properties of 5-methyl-2-(5-methylfuran-2-yl)-1,3-oxazinane?
5-methyl-2-(5-methylfuran-2-yl)-1,3-oxazinane has a molecular weight of 181.24 g/mol, XLogP of 1.84, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-2-(5-methylfuran-2-yl)-1,3-oxazinane is sourced from PubChem (CID 117226705), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).