About 5-methyl-2-(5-methylthiophen-2-yl)-1,3-oxazinane;hydrochloride
5-methyl-2-(5-methylthiophen-2-yl)-1,3-oxazinane;hydrochloride (PubChem CID 117226712) has the molecular formula C10H16ClNOS
and a molecular weight of 233.76 g/mol. Its IUPAC name is 5-methyl-2-(5-methylthiophen-2-yl)-1,3-oxazinane;hydrochloride.
Molecular Properties
| Compound Name | 5-methyl-2-(5-methylthiophen-2-yl)-1,3-oxazinane;hydrochloride |
| PubChem CID | 117226712 |
| Molecular Formula | C10H16ClNOS |
| Molecular Weight | 233.76 g/mol |
| Exact Mass | 233.06 |
| IUPAC Name | 5-methyl-2-(5-methylthiophen-2-yl)-1,3-oxazinane;hydrochloride |
| SMILES | Cc1ccc(C2NCC(C)CO2)s1.Cl |
| InChI | InChI=1S/C10H15NOS.ClH/c1-7-5-11-10(12-6-7)9-4-3-8(2)13-9;/h3-4,7,10-11H,5-6H2,1-2H3;1H |
| InChIKey | QWKKHJKDOFGKJT-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.76 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-methyl-2-(5-methylthiophen-2-yl)-1,3-oxazinane;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-2-(5-methylthiophen-2-yl)-1,3-oxazinane;hydrochloride?
The IUPAC name of 5-methyl-2-(5-methylthiophen-2-yl)-1,3-oxazinane;hydrochloride (CID 117226712) is 5-methyl-2-(5-methylthiophen-2-yl)-1,3-oxazinane;hydrochloride.
What is the SMILES notation for 5-methyl-2-(5-methylthiophen-2-yl)-1,3-oxazinane;hydrochloride?
The canonical SMILES for 5-methyl-2-(5-methylthiophen-2-yl)-1,3-oxazinane;hydrochloride is Cc1ccc(C2NCC(C)CO2)s1.Cl.
What is the InChIKey of 5-methyl-2-(5-methylthiophen-2-yl)-1,3-oxazinane;hydrochloride?
The InChIKey is QWKKHJKDOFGKJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NOS.ClH/c1-7-5-11-10(12-6-7)9-4-3-8(2)13-9;/h3-4,7,10-11H,5-6H2,1-2H3;1H.
What are the key properties of 5-methyl-2-(5-methylthiophen-2-yl)-1,3-oxazinane;hydrochloride?
5-methyl-2-(5-methylthiophen-2-yl)-1,3-oxazinane;hydrochloride has a molecular weight of 233.76 g/mol, XLogP of 2.73, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-2-(5-methylthiophen-2-yl)-1,3-oxazinane;hydrochloride is sourced from PubChem (CID 117226712), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).