C11H16BrNO2 — CID 117226757
2-(5-bromofuran-2-yl)-2,5,5-trimethyl-1,3-oxazinane (PubChem CID 117226757) has the molecular formula C11H16BrNO2 and a molecular weight of 274.16 g/mol. Its IUPAC name is 2-(5-bromofuran-2-yl)-2,5,5-trimethyl-1,3-oxazinane.
| Compound Name | 2-(5-bromofuran-2-yl)-2,5,5-trimethyl-1,3-oxazinane |
|---|---|
| PubChem CID | 117226757 |
| Molecular Formula | C11H16BrNO2 |
| Molecular Weight | 274.16 g/mol |
| Exact Mass | 273.04 |
| IUPAC Name | 2-(5-bromofuran-2-yl)-2,5,5-trimethyl-1,3-oxazinane |
| SMILES | CC1(C)CNC(C)(c2ccc(Br)o2)OC1 |
| InChI | InChI=1S/C11H16BrNO2/c1-10(2)6-13-11(3,14-7-10)8-4-5-9(12)15-8/h4-5,13H,6-7H2,1-3H3 |
| InChIKey | CVNUCNPGOWJXLT-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.16 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |