C8H17NO — CID 117226941
2-ethyl-2,5-dimethyl-1,3-oxazinane (PubChem CID 117226941) has the molecular formula C8H17NO and a molecular weight of 143.23 g/mol. Its IUPAC name is 2-ethyl-2,5-dimethyl-1,3-oxazinane.
| Compound Name | 2-ethyl-2,5-dimethyl-1,3-oxazinane |
|---|---|
| PubChem CID | 117226941 |
| Molecular Formula | C8H17NO |
| Molecular Weight | 143.23 g/mol |
| Exact Mass | 143.13 |
| IUPAC Name | 2-ethyl-2,5-dimethyl-1,3-oxazinane |
| SMILES | CCC1(C)NCC(C)CO1 |
| InChI | InChI=1S/C8H17NO/c1-4-8(3)9-5-7(2)6-10-8/h7,9H,4-6H2,1-3H3 |
| InChIKey | UFLMXUPCYRGRNB-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.23 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |