About 5,5-dimethyl-2-(3-methylphenyl)-1,3-oxazinane
5,5-dimethyl-2-(3-methylphenyl)-1,3-oxazinane (PubChem CID 117227011) has the molecular formula C13H19NO
and a molecular weight of 205.30 g/mol. Its IUPAC name is 5,5-dimethyl-2-(3-methylphenyl)-1,3-oxazinane.
Molecular Properties
| Compound Name | 5,5-dimethyl-2-(3-methylphenyl)-1,3-oxazinane |
| PubChem CID | 117227011 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | 5,5-dimethyl-2-(3-methylphenyl)-1,3-oxazinane |
| SMILES | Cc1cccc(C2NCC(C)(C)CO2)c1 |
| InChI | InChI=1S/C13H19NO/c1-10-5-4-6-11(7-10)12-14-8-13(2,3)9-15-12/h4-7,12,14H,8-9H2,1-3H3 |
| InChIKey | GXZUCKWBKWJVGZ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5,5-dimethyl-2-(3-methylphenyl)-1,3-oxazinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-dimethyl-2-(3-methylphenyl)-1,3-oxazinane?
The IUPAC name of 5,5-dimethyl-2-(3-methylphenyl)-1,3-oxazinane (CID 117227011) is 5,5-dimethyl-2-(3-methylphenyl)-1,3-oxazinane.
What is the SMILES notation for 5,5-dimethyl-2-(3-methylphenyl)-1,3-oxazinane?
The canonical SMILES for 5,5-dimethyl-2-(3-methylphenyl)-1,3-oxazinane is Cc1cccc(C2NCC(C)(C)CO2)c1.
What is the InChIKey of 5,5-dimethyl-2-(3-methylphenyl)-1,3-oxazinane?
The InChIKey is GXZUCKWBKWJVGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19NO/c1-10-5-4-6-11(7-10)12-14-8-13(2,3)9-15-12/h4-7,12,14H,8-9H2,1-3H3.
What are the key properties of 5,5-dimethyl-2-(3-methylphenyl)-1,3-oxazinane?
5,5-dimethyl-2-(3-methylphenyl)-1,3-oxazinane has a molecular weight of 205.30 g/mol, XLogP of 2.64, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-dimethyl-2-(3-methylphenyl)-1,3-oxazinane is sourced from PubChem (CID 117227011), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).