About 3-(2,5-dimethyl-1,3-oxazinan-2-yl)phenol
3-(2,5-dimethyl-1,3-oxazinan-2-yl)phenol (PubChem CID 117227041) has the molecular formula C12H17NO2
and a molecular weight of 207.27 g/mol. Its IUPAC name is 3-(2,5-dimethyl-1,3-oxazinan-2-yl)phenol.
Molecular Properties
| Compound Name | 3-(2,5-dimethyl-1,3-oxazinan-2-yl)phenol |
| PubChem CID | 117227041 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | 3-(2,5-dimethyl-1,3-oxazinan-2-yl)phenol |
| SMILES | CC1CNC(C)(c2cccc(O)c2)OC1 |
| InChI | InChI=1S/C12H17NO2/c1-9-7-13-12(2,15-8-9)10-4-3-5-11(14)6-10/h3-6,9,13-14H,7-8H2,1-2H3 |
| InChIKey | SWHWHXPCPLSBKI-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(2,5-dimethyl-1,3-oxazinan-2-yl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,5-dimethyl-1,3-oxazinan-2-yl)phenol?
The IUPAC name of 3-(2,5-dimethyl-1,3-oxazinan-2-yl)phenol (CID 117227041) is 3-(2,5-dimethyl-1,3-oxazinan-2-yl)phenol.
What is the SMILES notation for 3-(2,5-dimethyl-1,3-oxazinan-2-yl)phenol?
The canonical SMILES for 3-(2,5-dimethyl-1,3-oxazinan-2-yl)phenol is CC1CNC(C)(c2cccc(O)c2)OC1.
What is the InChIKey of 3-(2,5-dimethyl-1,3-oxazinan-2-yl)phenol?
The InChIKey is SWHWHXPCPLSBKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO2/c1-9-7-13-12(2,15-8-9)10-4-3-5-11(14)6-10/h3-6,9,13-14H,7-8H2,1-2H3.
What are the key properties of 3-(2,5-dimethyl-1,3-oxazinan-2-yl)phenol?
3-(2,5-dimethyl-1,3-oxazinan-2-yl)phenol has a molecular weight of 207.27 g/mol, XLogP of 1.82, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,5-dimethyl-1,3-oxazinan-2-yl)phenol is sourced from PubChem (CID 117227041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).