C9H17NOS — CID 117227291
2-methyl-2-(thiolan-3-ylmethyl)-1,3-oxazolidine (PubChem CID 117227291) has the molecular formula C9H17NOS and a molecular weight of 187.31 g/mol. Its IUPAC name is 2-methyl-2-(thiolan-3-ylmethyl)-1,3-oxazolidine.
| Compound Name | 2-methyl-2-(thiolan-3-ylmethyl)-1,3-oxazolidine |
|---|---|
| PubChem CID | 117227291 |
| Molecular Formula | C9H17NOS |
| Molecular Weight | 187.31 g/mol |
| Exact Mass | 187.10 |
| IUPAC Name | 2-methyl-2-(thiolan-3-ylmethyl)-1,3-oxazolidine |
| SMILES | CC1(CC2CCSC2)NCCO1 |
| InChI | InChI=1S/C9H17NOS/c1-9(10-3-4-11-9)6-8-2-5-12-7-8/h8,10H,2-7H2,1H3 |
| InChIKey | STIJCTMAOYBBKD-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.31 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |