About 2-(3-fluorophenyl)-2-methyl-1,3-oxazolidine;hydrochloride
2-(3-fluorophenyl)-2-methyl-1,3-oxazolidine;hydrochloride (PubChem CID 117227522) has the molecular formula C10H13ClFNO
and a molecular weight of 217.67 g/mol. Its IUPAC name is 2-(3-fluorophenyl)-2-methyl-1,3-oxazolidine;hydrochloride.
Molecular Properties
| Compound Name | 2-(3-fluorophenyl)-2-methyl-1,3-oxazolidine;hydrochloride |
| PubChem CID | 117227522 |
| Molecular Formula | C10H13ClFNO |
| Molecular Weight | 217.67 g/mol |
| Exact Mass | 217.07 |
| IUPAC Name | 2-(3-fluorophenyl)-2-methyl-1,3-oxazolidine;hydrochloride |
| SMILES | CC1(c2cccc(F)c2)NCCO1.Cl |
| InChI | InChI=1S/C10H12FNO.ClH/c1-10(12-5-6-13-10)8-3-2-4-9(11)7-8;/h2-4,7,12H,5-6H2,1H3;1H |
| InChIKey | WWAOFVTXTCQUHZ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.67 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(3-fluorophenyl)-2-methyl-1,3-oxazolidine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-fluorophenyl)-2-methyl-1,3-oxazolidine;hydrochloride?
The IUPAC name of 2-(3-fluorophenyl)-2-methyl-1,3-oxazolidine;hydrochloride (CID 117227522) is 2-(3-fluorophenyl)-2-methyl-1,3-oxazolidine;hydrochloride.
What is the SMILES notation for 2-(3-fluorophenyl)-2-methyl-1,3-oxazolidine;hydrochloride?
The canonical SMILES for 2-(3-fluorophenyl)-2-methyl-1,3-oxazolidine;hydrochloride is CC1(c2cccc(F)c2)NCCO1.Cl.
What is the InChIKey of 2-(3-fluorophenyl)-2-methyl-1,3-oxazolidine;hydrochloride?
The InChIKey is WWAOFVTXTCQUHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12FNO.ClH/c1-10(12-5-6-13-10)8-3-2-4-9(11)7-8;/h2-4,7,12H,5-6H2,1H3;1H.
What are the key properties of 2-(3-fluorophenyl)-2-methyl-1,3-oxazolidine;hydrochloride?
2-(3-fluorophenyl)-2-methyl-1,3-oxazolidine;hydrochloride has a molecular weight of 217.67 g/mol, XLogP of 2.04, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-fluorophenyl)-2-methyl-1,3-oxazolidine;hydrochloride is sourced from PubChem (CID 117227522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).