C13H18ClNO — CID 117228367
2-[(4-chlorophenyl)methyl]-2,4,4-trimethyl-1,3-oxazolidine (PubChem CID 117228367) has the molecular formula C13H18ClNO and a molecular weight of 239.75 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)methyl]-2,4,4-trimethyl-1,3-oxazolidine.
| Compound Name | 2-[(4-chlorophenyl)methyl]-2,4,4-trimethyl-1,3-oxazolidine |
|---|---|
| PubChem CID | 117228367 |
| Molecular Formula | C13H18ClNO |
| Molecular Weight | 239.75 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | 2-[(4-chlorophenyl)methyl]-2,4,4-trimethyl-1,3-oxazolidine |
| SMILES | CC1(C)COC(C)(Cc2ccc(Cl)cc2)N1 |
| InChI | InChI=1S/C13H18ClNO/c1-12(2)9-16-13(3,15-12)8-10-4-6-11(14)7-5-10/h4-7,15H,8-9H2,1-3H3 |
| InChIKey | DSISXDAURUKRHW-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.75 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |