C15H19BrO2 — CID 11722962
(2R,3aR,5S,6aR)-5-(3-bromopropa-1,2-dienyl)-2-[(1E,3E)-hexa-1,3-dienyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan (PubChem CID 11722962) has the molecular formula C15H19BrO2 and a molecular weight of 311.22 g/mol. Its IUPAC name is (2R,3aR,5S,6aR)-5-(3-bromopropa-1,2-dienyl)-2-[(1E,3E)-hexa-1,3-dienyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan.
| Compound Name | (2R,3aR,5S,6aR)-5-(3-bromopropa-1,2-dienyl)-2-[(1E,3E)-hexa-1,3-dienyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan |
|---|---|
| PubChem CID | 11722962 |
| Molecular Formula | C15H19BrO2 |
| Molecular Weight | 311.22 g/mol |
| Exact Mass | 310.06 |
| IUPAC Name | (2R,3aR,5S,6aR)-5-(3-bromopropa-1,2-dienyl)-2-[(1E,3E)-hexa-1,3-dienyl]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan |
| SMILES | CC/C=C/C=C/[C@H]1C[C@H]2O[C@H](C=C=CBr)C[C@H]2O1 |
| InChI | InChI=1S/C15H19BrO2/c1-2-3-4-5-7-12-10-14-15(17-12)11-13(18-14)8-6-9-16/h3-5,7-9,12-15H,2,10-11H2,1H3/b4-3+,7-5+/t6?,12-,13+,14+,15+/m0/s1 |
| InChIKey | QUYABHYIAYVLIC-GXAMOEALSA-N |
| XLogP | 3.89 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.22 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|