C14H12F3N3O2 — CID 11722965
2-(trifluoromethyl)-4-(3,4,4-trimethyl-2,5-dioxoimidazolidin-1-yl)benzonitrile (PubChem CID 11722965) has the molecular formula C14H12F3N3O2 and a molecular weight of 311.26 g/mol. Its IUPAC name is 2-(trifluoromethyl)-4-(3,4,4-trimethyl-2,5-dioxoimidazolidin-1-yl)benzonitrile.
| Compound Name | 2-(trifluoromethyl)-4-(3,4,4-trimethyl-2,5-dioxoimidazolidin-1-yl)benzonitrile |
|---|---|
| PubChem CID | 11722965 |
| Molecular Formula | C14H12F3N3O2 |
| Molecular Weight | 311.26 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | 2-(trifluoromethyl)-4-(3,4,4-trimethyl-2,5-dioxoimidazolidin-1-yl)benzonitrile |
| SMILES | CN1C(=O)N(c2ccc(C#N)c(C(F)(F)F)c2)C(=O)C1(C)C |
| InChI | InChI=1S/C14H12F3N3O2/c1-13(2)11(21)20(12(22)19(13)3)9-5-4-8(7-18)10(6-9)14(15,16)17/h4-6H,1-3H3 |
| InChIKey | WMLOLADEYUIUJD-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 64.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.26 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|