C15H20O7 — CID 11723018
methyl (1S,4aS,5R,7S,7aR)-1,5-diacetyloxy-7-methyl-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-4-carboxylate (PubChem CID 11723018) has the molecular formula C15H20O7 and a molecular weight of 312.32 g/mol. Its IUPAC name is methyl (1S,4aS,5R,7S,7aR)-1,5-diacetyloxy-7-methyl-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-4-carboxylate.
| Compound Name | methyl (1S,4aS,5R,7S,7aR)-1,5-diacetyloxy-7-methyl-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-4-carboxylate |
|---|---|
| PubChem CID | 11723018 |
| Molecular Formula | C15H20O7 |
| Molecular Weight | 312.32 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | methyl (1S,4aS,5R,7S,7aR)-1,5-diacetyloxy-7-methyl-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-4-carboxylate |
| SMILES | COC(=O)C1=CO[C@@H](OC(C)=O)[C@H]2[C@@H]1[C@H](OC(C)=O)C[C@@H]2C |
| InChI | InChI=1S/C15H20O7/c1-7-5-11(21-8(2)16)13-10(14(18)19-4)6-20-15(12(7)13)22-9(3)17/h6-7,11-13,15H,5H2,1-4H3/t7-,11+,12+,13-,15-/m0/s1 |
| InChIKey | MVLUZZJQQKGNMJ-VUOWJXOESA-N |
| XLogP | 1.17 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.32 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|