About 2-(4,6-diaminopyrimidin-2-yl)sulfanyl-N-(2-morpholin-4-ylphenyl)acetamide
2-(4,6-diaminopyrimidin-2-yl)sulfanyl-N-(2-morpholin-4-ylphenyl)acetamide (PubChem CID 1172310) has the molecular formula C16H20N6O2S
and a molecular weight of 360.44 g/mol. Its IUPAC name is 2-(4,6-diaminopyrimidin-2-yl)sulfanyl-N-(2-morpholin-4-ylphenyl)acetamide.
Molecular Properties
| Compound Name | 2-(4,6-diaminopyrimidin-2-yl)sulfanyl-N-(2-morpholin-4-ylphenyl)acetamide |
| PubChem CID | 1172310 |
| Molecular Formula | C16H20N6O2S |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | 2-(4,6-diaminopyrimidin-2-yl)sulfanyl-N-(2-morpholin-4-ylphenyl)acetamide |
| SMILES | Nc1cc(N)nc(SCC(=O)Nc2ccccc2N2CCOCC2)n1 |
| InChI | InChI=1S/C16H20N6O2S/c17-13-9-14(18)21-16(20-13)25-10-15(23)19-11-3-1-2-4-12(11)22-5-7-24-8-6-22/h1-4,9H,5-8,10H2,(H,19,23)(H4,17,18,20,21) |
| InChIKey | FKEGBBNKHRTWDD-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 119.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 2-(4,6-diaminopyrimidin-2-yl)sulfanyl-N-(2-morpholin-4-ylphenyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,6-diaminopyrimidin-2-yl)sulfanyl-N-(2-morpholin-4-ylphenyl)acetamide?
The IUPAC name of 2-(4,6-diaminopyrimidin-2-yl)sulfanyl-N-(2-morpholin-4-ylphenyl)acetamide (CID 1172310) is 2-(4,6-diaminopyrimidin-2-yl)sulfanyl-N-(2-morpholin-4-ylphenyl)acetamide.
What is the SMILES notation for 2-(4,6-diaminopyrimidin-2-yl)sulfanyl-N-(2-morpholin-4-ylphenyl)acetamide?
The canonical SMILES for 2-(4,6-diaminopyrimidin-2-yl)sulfanyl-N-(2-morpholin-4-ylphenyl)acetamide is Nc1cc(N)nc(SCC(=O)Nc2ccccc2N2CCOCC2)n1.
What is the InChIKey of 2-(4,6-diaminopyrimidin-2-yl)sulfanyl-N-(2-morpholin-4-ylphenyl)acetamide?
The InChIKey is FKEGBBNKHRTWDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20N6O2S/c17-13-9-14(18)21-16(20-13)25-10-15(23)19-11-3-1-2-4-12(11)22-5-7-24-8-6-22/h1-4,9H,5-8,10H2,(H,19,23)(H4,17,18,20,21).
What are the key properties of 2-(4,6-diaminopyrimidin-2-yl)sulfanyl-N-(2-morpholin-4-ylphenyl)acetamide?
2-(4,6-diaminopyrimidin-2-yl)sulfanyl-N-(2-morpholin-4-ylphenyl)acetamide has a molecular weight of 360.44 g/mol, XLogP of 1.21, 5 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,6-diaminopyrimidin-2-yl)sulfanyl-N-(2-morpholin-4-ylphenyl)acetamide is sourced from PubChem (CID 1172310), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).