C20H27NO2 — CID 11723111
(8R,9S,10S,13S,14S)-10-[(2S)-aziridin-2-yl]-13-methyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,17-dione (PubChem CID 11723111) has the molecular formula C20H27NO2 and a molecular weight of 313.44 g/mol. Its IUPAC name is (8R,9S,10S,13S,14S)-10-[(2S)-aziridin-2-yl]-13-methyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,17-dione.
| Compound Name | (8R,9S,10S,13S,14S)-10-[(2S)-aziridin-2-yl]-13-methyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,17-dione |
|---|---|
| PubChem CID | 11723111 |
| Molecular Formula | C20H27NO2 |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.20 |
| IUPAC Name | (8R,9S,10S,13S,14S)-10-[(2S)-aziridin-2-yl]-13-methyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthrene-3,17-dione |
| SMILES | C[C@]12CC[C@H]3[C@@H](CCC4=CC(=O)CC[C@@]43[C@H]3CN3)[C@@H]1CCC2=O |
| InChI | InChI=1S/C20H27NO2/c1-19-8-7-16-14(15(19)4-5-18(19)23)3-2-12-10-13(22)6-9-20(12,16)17-11-21-17/h10,14-17,21H,2-9,11H2,1H3/t14-,15-,16-,17+,19-,20+/m0/s1 |
| InChIKey | BWBGFCKUCGDIQU-WDYSCTGBSA-N |
| XLogP | 3.04 |
| TPSA | 56.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|