C7H5F11O — CID 11723125
3,3,4,4,5,5,6,6,7,7,7-undecafluoroheptan-1-ol (PubChem CID 11723125) has the molecular formula C7H5F11O and a molecular weight of 314.09 g/mol. Its IUPAC name is 3,3,4,4,5,5,6,6,7,7,7-undecafluoroheptan-1-ol.
| Compound Name | 3,3,4,4,5,5,6,6,7,7,7-undecafluoroheptan-1-ol |
|---|---|
| PubChem CID | 11723125 |
| Molecular Formula | C7H5F11O |
| Molecular Weight | 314.09 g/mol |
| Exact Mass | 314.02 |
| IUPAC Name | 3,3,4,4,5,5,6,6,7,7,7-undecafluoroheptan-1-ol |
| SMILES | OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7H5F11O/c8-3(9,1-2-19)4(10,11)5(12,13)6(14,15)7(16,17)18/h19H,1-2H2 |
| InChIKey | NPOAVCPGPRUNOX-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.09 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|