C8H14N4O — CID 117231268
5-[3-(methylamino)propoxy]pyrimidin-2-amine (PubChem CID 117231268) has the molecular formula C8H14N4O and a molecular weight of 182.23 g/mol. Its IUPAC name is 5-[3-(methylamino)propoxy]pyrimidin-2-amine.
| Compound Name | 5-[3-(methylamino)propoxy]pyrimidin-2-amine |
|---|---|
| PubChem CID | 117231268 |
| Molecular Formula | C8H14N4O |
| Molecular Weight | 182.23 g/mol |
| Exact Mass | 182.12 |
| IUPAC Name | 5-[3-(methylamino)propoxy]pyrimidin-2-amine |
| SMILES | CNCCCOc1cnc(N)nc1 |
| InChI | InChI=1S/C8H14N4O/c1-10-3-2-4-13-7-5-11-8(9)12-6-7/h5-6,10H,2-4H2,1H3,(H2,9,11,12) |
| InChIKey | KVWNMHRUQVKVGA-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.23 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|